4-Difluoromethoxy-3-hydroxybenzaldehyde
Catalog No: FT-0643464
CAS No: 151103-08-1
- Chemical Name: 4-Difluoromethoxy-3-hydroxybenzaldehyde
- Molecular Formula: C8H6F2O3
- Molecular Weight: 188.13
- InChI Key: ZLIKNROJGXXNJG-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6F2O3/c9-8(10)13-7-2-1-5(4-11)3-6(7)12/h1-4,8,12H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 188.128 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 151103-08-1 |
| Bolling_Point: | 280.6±35.0 °C at 760 mmHg |
| Product_Name: | 4-Difluoromethoxy-3-hydroxybenzaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | 123.5±25.9 °C |
| MF: | C8H6F2O3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.28 |
| Flash_Point: | 123.5±25.9 °C |
| Refractive_Index: | 1.533 |
| FW: | 188.128 |
| PSA: | 46.53000 |
| MF: | C8H6F2O3 |
| Bolling_Point: | 280.6±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 188.028503 |
| Hazard_Codes: | Xi:Irritant; |
|---|---|
| Warning_Statement: | P261-P273-P305 + P351 + P338 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2913000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)